C21H31ClO4 — CID 162970635
methyl (1S,3R,4S,8R,9S,10S,12S)-10-chloro-3-hydroxy-9,12-dimethyl-9-(4-methylpent-3-enyl)-2-oxatricyclo[6.3.1.04,12]dodec-5-ene-5-carboxylate (PubChem CID 162970635) has the molecular formula C21H31ClO4 and a molecular weight of 382.93 g/mol. Its IUPAC name is methyl (1S,3R,4S,8R,9S,10S,12S)-10-chloro-3-hydroxy-9,12-dimethyl-9-(4-methylpent-3-enyl)-2-oxatricyclo[6.3.1.04,12]dodec-5-ene-5-carboxylate.
| Compound Name | methyl (1S,3R,4S,8R,9S,10S,12S)-10-chloro-3-hydroxy-9,12-dimethyl-9-(4-methylpent-3-enyl)-2-oxatricyclo[6.3.1.04,12]dodec-5-ene-5-carboxylate |
|---|---|
| PubChem CID | 162970635 |
| Molecular Formula | C21H31ClO4 |
| Molecular Weight | 382.93 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | methyl (1S,3R,4S,8R,9S,10S,12S)-10-chloro-3-hydroxy-9,12-dimethyl-9-(4-methylpent-3-enyl)-2-oxatricyclo[6.3.1.04,12]dodec-5-ene-5-carboxylate |
| SMILES | COC(=O)C1=CC[C@H]2[C@](C)(CCC=C(C)C)[C@@H](Cl)C[C@@H]3O[C@@H](O)[C@H]1[C@@]32C |
| InChI | InChI=1S/C21H31ClO4/c1-12(2)7-6-10-20(3)14-9-8-13(18(23)25-5)17-19(24)26-16(11-15(20)22)21(14,17)4/h7-8,14-17,19,24H,6,9-11H2,1-5H3/t14-,15-,16-,17-,19+,20-,21+/m0/s1 |
| InChIKey | SRJIDFQIECGKBW-CWZKNBAESA-N |
| XLogP | 4.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.93 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|