C14H22 — CID 163060993
(1S,6R)-6-methyl-6-(4-methylpent-3-enyl)bicyclo[3.1.1]hept-2-ene (PubChem CID 163060993) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is (1S,6R)-6-methyl-6-(4-methylpent-3-enyl)bicyclo[3.1.1]hept-2-ene.
| Compound Name | (1S,6R)-6-methyl-6-(4-methylpent-3-enyl)bicyclo[3.1.1]hept-2-ene |
|---|---|
| PubChem CID | 163060993 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (1S,6R)-6-methyl-6-(4-methylpent-3-enyl)bicyclo[3.1.1]hept-2-ene |
| SMILES | CC(C)=CCC[C@]1(C)C2CC=C[C@@H]1C2 |
| InChI | InChI=1S/C14H22/c1-11(2)6-5-9-14(3)12-7-4-8-13(14)10-12/h4,6-7,12-13H,5,8-10H2,1-3H3/t12-,13?,14+/m1/s1 |
| InChIKey | BBSXSTLVJUTZRU-YIOYIWSBSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|