C23H36O2 — CID 90139121
(1R,3R,7R,8S,10S)-4-methoxy-8,10-dimethyl-3-(3-methylbut-2-enyl)-10-(4-methylpent-3-enyl)-9-oxatricyclo[5.2.1.03,8]dec-4-ene (PubChem CID 90139121) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is (1R,3R,7R,8S,10S)-4-methoxy-8,10-dimethyl-3-(3-methylbut-2-enyl)-10-(4-methylpent-3-enyl)-9-oxatricyclo[5.2.1.03,8]dec-4-ene.
| Compound Name | (1R,3R,7R,8S,10S)-4-methoxy-8,10-dimethyl-3-(3-methylbut-2-enyl)-10-(4-methylpent-3-enyl)-9-oxatricyclo[5.2.1.03,8]dec-4-ene |
|---|---|
| PubChem CID | 90139121 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | (1R,3R,7R,8S,10S)-4-methoxy-8,10-dimethyl-3-(3-methylbut-2-enyl)-10-(4-methylpent-3-enyl)-9-oxatricyclo[5.2.1.03,8]dec-4-ene |
| SMILES | COC1=CC[C@H]2[C@]3(C)OC(C[C@]13CC=C(C)C)[C@@]2(C)CCC=C(C)C |
| InChI | InChI=1S/C23H36O2/c1-16(2)9-8-13-21(5)18-10-11-19(24-7)23(14-12-17(3)4)15-20(21)25-22(18,23)6/h9,11-12,18,20H,8,10,13-15H2,1-7H3/t18-,20?,21+,22+,23-/m1/s1 |
| InChIKey | JLAAQKRJJBSWTP-AWRRLRFUSA-N |
| XLogP | 6.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|