C27H44O3Si — CID 90139134
(9R)-6,9-dimethoxy-2,9-dimethyl-5-(3-methylbut-2-enyl)-2-(4-methylpent-3-enyl)-7-trimethylsilyltricyclo[3.3.1.01,3]non-6-en-8-one (PubChem CID 90139134) has the molecular formula C27H44O3Si and a molecular weight of 444.73 g/mol. Its IUPAC name is (9R)-6,9-dimethoxy-2,9-dimethyl-5-(3-methylbut-2-enyl)-2-(4-methylpent-3-enyl)-7-trimethylsilyltricyclo[3.3.1.01,3]non-6-en-8-one.
| Compound Name | (9R)-6,9-dimethoxy-2,9-dimethyl-5-(3-methylbut-2-enyl)-2-(4-methylpent-3-enyl)-7-trimethylsilyltricyclo[3.3.1.01,3]non-6-en-8-one |
|---|---|
| PubChem CID | 90139134 |
| Molecular Formula | C27H44O3Si |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | (9R)-6,9-dimethoxy-2,9-dimethyl-5-(3-methylbut-2-enyl)-2-(4-methylpent-3-enyl)-7-trimethylsilyltricyclo[3.3.1.01,3]non-6-en-8-one |
| SMILES | COC1=C([Si](C)(C)C)C(=O)C23C(CC1(CC=C(C)C)[C@@]2(C)OC)C3(C)CCC=C(C)C |
| InChI | InChI=1S/C27H44O3Si/c1-18(2)13-12-15-24(5)20-17-26(16-14-19(3)4)23(29-7)21(31(9,10)11)22(28)27(20,24)25(26,6)30-8/h13-14,20H,12,15-17H2,1-11H3/t20?,24?,25-,26?,27?/m1/s1 |
| InChIKey | JTSFSIPLRSDGAW-WXFFCOBRSA-N |
| XLogP | 6.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|