C40H70O5Si2 — CID 78096257
4-methoxy-8-methyl-5,7-bis(3-methylbut-2-enyl)-1-(2-methylpropanoyl)-8-(4-methyl-4-triethylsilyloxypentyl)-3-trimethylsilylbicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 78096257) has the molecular formula C40H70O5Si2 and a molecular weight of 687.17 g/mol. Its IUPAC name is 4-methoxy-8-methyl-5,7-bis(3-methylbut-2-enyl)-1-(2-methylpropanoyl)-8-(4-methyl-4-triethylsilyloxypentyl)-3-trimethylsilylbicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | 4-methoxy-8-methyl-5,7-bis(3-methylbut-2-enyl)-1-(2-methylpropanoyl)-8-(4-methyl-4-triethylsilyloxypentyl)-3-trimethylsilylbicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 78096257 |
| Molecular Formula | C40H70O5Si2 |
| Molecular Weight | 687.17 g/mol |
| Exact Mass | 686.48 |
| IUPAC Name | 4-methoxy-8-methyl-5,7-bis(3-methylbut-2-enyl)-1-(2-methylpropanoyl)-8-(4-methyl-4-triethylsilyloxypentyl)-3-trimethylsilylbicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | CC[Si](CC)(CC)OC(C)(C)CCCC1(C)C(CC=C(C)C)CC2(CC=C(C)C)C(=O)C1(C(=O)C(C)C)C(=O)C([Si](C)(C)C)=C2OC |
| InChI | InChI=1S/C40H70O5Si2/c1-17-47(18-2,19-3)45-37(10,11)24-20-25-38(12)31(22-21-28(4)5)27-39(26-23-29(6)7)35(44-13)32(46(14,15)16)34(42)40(38,36(39)43)33(41)30(8)9/h21,23,30-31H,17-20,22,24-27H2,1-16H3 |
| InChIKey | WSLYHDXETGYEEU-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.17 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|