C10H18N2O4 — CID 107824979
(2S)-2-[(2-amino-2-cyclopropylpropanoyl)amino]-4-hydroxybutanoic acid (PubChem CID 107824979) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is (2S)-2-[(2-amino-2-cyclopropylpropanoyl)amino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[(2-amino-2-cyclopropylpropanoyl)amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107824979 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (2S)-2-[(2-amino-2-cyclopropylpropanoyl)amino]-4-hydroxybutanoic acid |
| SMILES | CC(N)(C(=O)N[C@@H](CCO)C(=O)O)C1CC1 |
| InChI | InChI=1S/C10H18N2O4/c1-10(11,6-2-3-6)9(16)12-7(4-5-13)8(14)15/h6-7,13H,2-5,11H2,1H3,(H,12,16)(H,14,15)/t7-,10?/m0/s1 |
| InChIKey | UHPSPQMXDHWJJB-BYDSUWOYSA-N |
| XLogP | -0.93 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |