C11H18N2O6 — CID 107831537
(2R)-2-[[2-[acetyl(methyl)amino]acetyl]amino]hexanedioic acid (PubChem CID 107831537) has the molecular formula C11H18N2O6 and a molecular weight of 274.27 g/mol. Its IUPAC name is (2R)-2-[[2-[acetyl(methyl)amino]acetyl]amino]hexanedioic acid.
| Compound Name | (2R)-2-[[2-[acetyl(methyl)amino]acetyl]amino]hexanedioic acid |
|---|---|
| PubChem CID | 107831537 |
| Molecular Formula | C11H18N2O6 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (2R)-2-[[2-[acetyl(methyl)amino]acetyl]amino]hexanedioic acid |
| SMILES | CC(=O)N(C)CC(=O)N[C@H](CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H18N2O6/c1-7(14)13(2)6-9(15)12-8(11(18)19)4-3-5-10(16)17/h8H,3-6H2,1-2H3,(H,12,15)(H,16,17)(H,18,19)/t8-/m1/s1 |
| InChIKey | OQTAOPBODSHARE-MRVPVSSYSA-N |
| XLogP | -0.71 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |