C12H10N2O4 — CID 107842057
(E)-3-[4-(2,5-dioxoimidazolidin-1-yl)phenyl]prop-2-enoic acid (PubChem CID 107842057) has the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. Its IUPAC name is (E)-3-[4-(2,5-dioxoimidazolidin-1-yl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(2,5-dioxoimidazolidin-1-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107842057 |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (E)-3-[4-(2,5-dioxoimidazolidin-1-yl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(N2C(=O)CNC2=O)cc1 |
| InChI | InChI=1S/C12H10N2O4/c15-10-7-13-12(18)14(10)9-4-1-8(2-5-9)3-6-11(16)17/h1-6H,7H2,(H,13,18)(H,16,17)/b6-3+ |
| InChIKey | QHAYFMAWRCMFRX-ZZXKWVIFSA-N |
| XLogP | 0.84 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|