C11H9N3O2 — CID 115342576
(E)-3-[4-(1,2,4-triazol-4-yl)phenyl]prop-2-enoic acid (PubChem CID 115342576) has the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. Its IUPAC name is (E)-3-[4-(1,2,4-triazol-4-yl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(1,2,4-triazol-4-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115342576 |
| Molecular Formula | C11H9N3O2 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | (E)-3-[4-(1,2,4-triazol-4-yl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(-n2cnnc2)cc1 |
| InChI | InChI=1S/C11H9N3O2/c15-11(16)6-3-9-1-4-10(5-2-9)14-7-12-13-8-14/h1-8H,(H,15,16)/b6-3+ |
| InChIKey | XFPDQVGOABUOBG-ZZXKWVIFSA-N |
| XLogP | 1.37 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|