C15H16N4O — CID 107844315
5-amino-2-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxamide (PubChem CID 107844315) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 5-amino-2-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxamide.
| Compound Name | 5-amino-2-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 107844315 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 5-amino-2-(2,3-dihydro-1H-inden-2-ylamino)pyridine-3-carboxamide |
| SMILES | NC(=O)c1cc(N)cnc1NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H16N4O/c16-11-7-13(14(17)20)15(18-8-11)19-12-5-9-3-1-2-4-10(9)6-12/h1-4,7-8,12H,5-6,16H2,(H2,17,20)(H,18,19) |
| InChIKey | BFAVJSCUIWJTFC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |