C13H12Cl2N4O4 — CID 10784663
6-chloro-N-(2-chloro-4,6-dimethoxyphenyl)-2-methyl-5-nitropyrimidin-4-amine (PubChem CID 10784663) has the molecular formula C13H12Cl2N4O4 and a molecular weight of 359.17 g/mol. Its IUPAC name is 6-chloro-N-(2-chloro-4,6-dimethoxyphenyl)-2-methyl-5-nitropyrimidin-4-amine.
| Compound Name | 6-chloro-N-(2-chloro-4,6-dimethoxyphenyl)-2-methyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 10784663 |
| Molecular Formula | C13H12Cl2N4O4 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 6-chloro-N-(2-chloro-4,6-dimethoxyphenyl)-2-methyl-5-nitropyrimidin-4-amine |
| SMILES | COc1cc(Cl)c(Nc2nc(C)nc(Cl)c2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C13H12Cl2N4O4/c1-6-16-12(15)11(19(20)21)13(17-6)18-10-8(14)4-7(22-2)5-9(10)23-3/h4-5H,1-3H3,(H,16,17,18) |
| InChIKey | QWDFOHKLFROWGP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|