C21H16N2O4 — CID 10784738
(5Z)-1,3-dimethyl-5-[[4-(4-oxochromen-2-yl)phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 10784738) has the molecular formula C21H16N2O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is (5Z)-1,3-dimethyl-5-[[4-(4-oxochromen-2-yl)phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-1,3-dimethyl-5-[[4-(4-oxochromen-2-yl)phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10784738 |
| Molecular Formula | C21H16N2O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (5Z)-1,3-dimethyl-5-[[4-(4-oxochromen-2-yl)phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | CN1C(=O)/C(=C/c2ccc(-c3cc(=O)c4ccccc4o3)cc2)N(C)C1=O |
| InChI | InChI=1S/C21H16N2O4/c1-22-16(20(25)23(2)21(22)26)11-13-7-9-14(10-8-13)19-12-17(24)15-5-3-4-6-18(15)27-19/h3-12H,1-2H3/b16-11- |
| InChIKey | GVYRQCWTKJTDFS-WJDWOHSUSA-N |
| XLogP | 3.32 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|