C11H19NO5 — CID 107849864
1-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4,4-dimethylpiperidine-2,6-dione (PubChem CID 107849864) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is 1-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4,4-dimethylpiperidine-2,6-dione.
| Compound Name | 1-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4,4-dimethylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 107849864 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 1-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4,4-dimethylpiperidine-2,6-dione |
| SMILES | CC1(C)CC(=O)N(C(CO)(CO)CO)C(=O)C1 |
| InChI | InChI=1S/C11H19NO5/c1-10(2)3-8(16)12(9(17)4-10)11(5-13,6-14)7-15/h13-15H,3-7H2,1-2H3 |
| InChIKey | LYABQXKEBWLOJD-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|