C7H13NO2 — CID 140856572
1-(hydroxymethyl)-5,5-dimethylpyrrolidin-2-one (PubChem CID 140856572) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is 1-(hydroxymethyl)-5,5-dimethylpyrrolidin-2-one.
| Compound Name | 1-(hydroxymethyl)-5,5-dimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 140856572 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 1-(hydroxymethyl)-5,5-dimethylpyrrolidin-2-one |
| SMILES | CC1(C)CCC(=O)N1CO |
| InChI | InChI=1S/C7H13NO2/c1-7(2)4-3-6(10)8(7)5-9/h9H,3-5H2,1-2H3 |
| InChIKey | LOTSWFGMBUDZBP-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |