C16H16N2O4S2 — CID 10785000
(NE)-N-[4-hydroxy-3-(2-methoxyphenyl)-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 10785000) has the molecular formula C16H16N2O4S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is (NE)-N-[4-hydroxy-3-(2-methoxyphenyl)-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | (NE)-N-[4-hydroxy-3-(2-methoxyphenyl)-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 10785000 |
| Molecular Formula | C16H16N2O4S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | (NE)-N-[4-hydroxy-3-(2-methoxyphenyl)-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | COc1ccccc1N1/C(=N\S(=O)(=O)c2ccccc2)SCC1O |
| InChI | InChI=1S/C16H16N2O4S2/c1-22-14-10-6-5-9-13(14)18-15(19)11-23-16(18)17-24(20,21)12-7-3-2-4-8-12/h2-10,15,19H,11H2,1H3/b17-16+ |
| InChIKey | LWSKKBTXZFNRAD-WUKNDPDISA-N |
| XLogP | 2.31 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|