C16H13FN2O4S2 — CID 2140708
4-fluoro-N-[3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 2140708) has the molecular formula C16H13FN2O4S2 and a molecular weight of 380.42 g/mol. Its IUPAC name is 4-fluoro-N-[3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 2140708 |
| Molecular Formula | C16H13FN2O4S2 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 4-fluoro-N-[3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | COc1ccc(N2C(=O)CSC2=NS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H13FN2O4S2/c1-23-13-6-4-12(5-7-13)19-15(20)10-24-16(19)18-25(21,22)14-8-2-11(17)3-9-14/h2-9H,10H2,1H3 |
| InChIKey | REYUVCLRZOMDHU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|