C23H17F2N3O4S — CID 11648456
5-(2,4-difluorophenyl)-2-hydroxy-N-[(E)-[3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzamide (PubChem CID 11648456) has the molecular formula C23H17F2N3O4S and a molecular weight of 469.47 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-2-hydroxy-N-[(E)-[3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzamide.
| Compound Name | 5-(2,4-difluorophenyl)-2-hydroxy-N-[(E)-[3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 11648456 |
| Molecular Formula | C23H17F2N3O4S |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 5-(2,4-difluorophenyl)-2-hydroxy-N-[(E)-[3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzamide |
| SMILES | COc1ccc(N2C(=O)CS/C2=N/NC(=O)c2cc(-c3ccc(F)cc3F)ccc2O)cc1 |
| InChI | InChI=1S/C23H17F2N3O4S/c1-32-16-6-4-15(5-7-16)28-21(30)12-33-23(28)27-26-22(31)18-10-13(2-9-20(18)29)17-8-3-14(24)11-19(17)25/h2-11,29H,12H2,1H3,(H,26,31)/b27-23+ |
| InChIKey | NNIWMAZTJMKODK-SLEBQGDGSA-N |
| XLogP | 4.13 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|