C17H13F2N3O3S — CID 15956002
5-(3,5-difluorophenyl)-2-hydroxy-N-[(E)-(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]benzamide (PubChem CID 15956002) has the molecular formula C17H13F2N3O3S and a molecular weight of 377.37 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)-2-hydroxy-N-[(E)-(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]benzamide.
| Compound Name | 5-(3,5-difluorophenyl)-2-hydroxy-N-[(E)-(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]benzamide |
|---|---|
| PubChem CID | 15956002 |
| Molecular Formula | C17H13F2N3O3S |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 5-(3,5-difluorophenyl)-2-hydroxy-N-[(E)-(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]benzamide |
| SMILES | CN1C(=O)CS/C1=N/NC(=O)c1cc(-c2cc(F)cc(F)c2)ccc1O |
| InChI | InChI=1S/C17H13F2N3O3S/c1-22-15(24)8-26-17(22)21-20-16(25)13-6-9(2-3-14(13)23)10-4-11(18)7-12(19)5-10/h2-7,23H,8H2,1H3,(H,20,25)/b21-17+ |
| InChIKey | WFYZTNBHAIFEPU-HEHNFIMWSA-N |
| XLogP | 2.54 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|