C18H15BFN3O2 — CID 123466513
CID 123466513 (PubChem CID 123466513) has the molecular formula C18H15BFN3O2 and a molecular weight of 335.15 g/mol.
| Compound Name | CID 123466513 |
|---|---|
| PubChem CID | 123466513 |
| Molecular Formula | C18H15BFN3O2 |
| Molecular Weight | 335.15 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(O)c(C(=O)NN=C(C)c2cc3cc(F)ccc3n2C)c1 |
| InChI | InChI=1S/C18H15BFN3O2/c1-10(16-8-11-7-13(20)4-5-15(11)23(16)2)21-22-18(25)14-9-12(19)3-6-17(14)24/h3-9,24H,1-2H3,(H,22,25) |
| InChIKey | IGVAEPYIBKBILU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.15 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|