C18H14BrF2N3O2 — CID 56966147
5-bromo-N-[(E)-1-(4,5-difluoro-1-methylindol-2-yl)ethylideneamino]-2-hydroxybenzamide (PubChem CID 56966147) has the molecular formula C18H14BrF2N3O2 and a molecular weight of 422.23 g/mol. Its IUPAC name is 5-bromo-N-[(E)-1-(4,5-difluoro-1-methylindol-2-yl)ethylideneamino]-2-hydroxybenzamide.
| Compound Name | 5-bromo-N-[(E)-1-(4,5-difluoro-1-methylindol-2-yl)ethylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 56966147 |
| Molecular Formula | C18H14BrF2N3O2 |
| Molecular Weight | 422.23 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 5-bromo-N-[(E)-1-(4,5-difluoro-1-methylindol-2-yl)ethylideneamino]-2-hydroxybenzamide |
| SMILES | C/C(=N\NC(=O)c1cc(Br)ccc1O)c1cc2c(F)c(F)ccc2n1C |
| InChI | InChI=1S/C18H14BrF2N3O2/c1-9(22-23-18(26)12-7-10(19)3-6-16(12)25)15-8-11-14(24(15)2)5-4-13(20)17(11)21/h3-8,25H,1-2H3,(H,23,26)/b22-9+ |
| InChIKey | GMYKCASPOYYORC-LSFURLLWSA-N |
| XLogP | 4.08 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.23 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|