C29H22F2O5 — CID 89023111
[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 5-(2,4-difluorophenyl)-2-hydroxybenzoate (PubChem CID 89023111) has the molecular formula C29H22F2O5 and a molecular weight of 488.49 g/mol. Its IUPAC name is [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 5-(2,4-difluorophenyl)-2-hydroxybenzoate.
| Compound Name | [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 5-(2,4-difluorophenyl)-2-hydroxybenzoate |
|---|---|
| PubChem CID | 89023111 |
| Molecular Formula | C29H22F2O5 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 5-(2,4-difluorophenyl)-2-hydroxybenzoate |
| SMILES | COc1cc(/C=C/c2ccc(OC(=O)c3cc(-c4ccc(F)cc4F)ccc3O)cc2)cc(OC)c1 |
| InChI | InChI=1S/C29H22F2O5/c1-34-23-13-19(14-24(17-23)35-2)4-3-18-5-9-22(10-6-18)36-29(33)26-15-20(7-12-28(26)32)25-11-8-21(30)16-27(25)31/h3-17,32H,1-2H3/b4-3+ |
| InChIKey | PJOLZSZKIOIJAY-ONEGZZNKSA-N |
| XLogP | 6.74 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|