C17H15FN2O4S2 — CID 6073230
(NE)-N-[3-(4-ethoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide (PubChem CID 6073230) has the molecular formula C17H15FN2O4S2 and a molecular weight of 394.45 g/mol. Its IUPAC name is (NE)-N-[3-(4-ethoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide.
| Compound Name | (NE)-N-[3-(4-ethoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 6073230 |
| Molecular Formula | C17H15FN2O4S2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | (NE)-N-[3-(4-ethoxyphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide |
| SMILES | CCOc1ccc(N2C(=O)CS/C2=N/S(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H15FN2O4S2/c1-2-24-14-7-5-13(6-8-14)20-16(21)11-25-17(20)19-26(22,23)15-9-3-12(18)4-10-15/h3-10H,2,11H2,1H3/b19-17+ |
| InChIKey | JVFXYCGRVCYQBR-HTXNQAPBSA-N |
| XLogP | 3.05 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|