C12H13NO2 — CID 107853805
(E)-3-(2,3-dihydro-1H-inden-2-ylamino)prop-2-enoic acid (PubChem CID 107853805) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1H-inden-2-ylamino)prop-2-enoic acid.
| Compound Name | (E)-3-(2,3-dihydro-1H-inden-2-ylamino)prop-2-enoic acid |
|---|---|
| PubChem CID | 107853805 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (E)-3-(2,3-dihydro-1H-inden-2-ylamino)prop-2-enoic acid |
| SMILES | O=C(O)/C=C/NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H13NO2/c14-12(15)5-6-13-11-7-9-3-1-2-4-10(9)8-11/h1-6,11,13H,7-8H2,(H,14,15)/b6-5+ |
| InChIKey | CXSWJPCJTOMJJY-AATRIKPKSA-N |
| XLogP | 1.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|