C9H13ClN2O3S — CID 107856823
2-chloro-N-[(2S)-1-hydroxybutan-2-yl]pyridine-4-sulfonamide (PubChem CID 107856823) has the molecular formula C9H13ClN2O3S and a molecular weight of 264.73 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-1-hydroxybutan-2-yl]pyridine-4-sulfonamide.
| Compound Name | 2-chloro-N-[(2S)-1-hydroxybutan-2-yl]pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 107856823 |
| Molecular Formula | C9H13ClN2O3S |
| Molecular Weight | 264.73 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 2-chloro-N-[(2S)-1-hydroxybutan-2-yl]pyridine-4-sulfonamide |
| SMILES | CC[C@@H](CO)NS(=O)(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C9H13ClN2O3S/c1-2-7(6-13)12-16(14,15)8-3-4-11-9(10)5-8/h3-5,7,12-13H,2,6H2,1H3/t7-/m0/s1 |
| InChIKey | RYDSJDHHNNDOKL-ZETCQYMHSA-N |
| XLogP | 0.78 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.73 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|