C10H9F2N3O4S — CID 107857437
1-cyano-N-(2,4-difluoro-6-nitrophenyl)propane-1-sulfonamide (PubChem CID 107857437) has the molecular formula C10H9F2N3O4S and a molecular weight of 305.26 g/mol. Its IUPAC name is 1-cyano-N-(2,4-difluoro-6-nitrophenyl)propane-1-sulfonamide.
| Compound Name | 1-cyano-N-(2,4-difluoro-6-nitrophenyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 107857437 |
| Molecular Formula | C10H9F2N3O4S |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 1-cyano-N-(2,4-difluoro-6-nitrophenyl)propane-1-sulfonamide |
| SMILES | CCC(C#N)S(=O)(=O)Nc1c(F)cc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9F2N3O4S/c1-2-7(5-13)20(18,19)14-10-8(12)3-6(11)4-9(10)15(16)17/h3-4,7,14H,2H2,1H3 |
| InChIKey | ODPWIWABGXRBJZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|