C17H27Cl2NO — CID 107867700
2-(1-adamantyl)-N-[1-chloro-2-(chloromethyl)butan-2-yl]acetamide (PubChem CID 107867700) has the molecular formula C17H27Cl2NO and a molecular weight of 332.32 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[1-chloro-2-(chloromethyl)butan-2-yl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[1-chloro-2-(chloromethyl)butan-2-yl]acetamide |
|---|---|
| PubChem CID | 107867700 |
| Molecular Formula | C17H27Cl2NO |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-(1-adamantyl)-N-[1-chloro-2-(chloromethyl)butan-2-yl]acetamide |
| SMILES | CCC(CCl)(CCl)NC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H27Cl2NO/c1-2-17(10-18,11-19)20-15(21)9-16-6-12-3-13(7-16)5-14(4-12)8-16/h12-14H,2-11H2,1H3,(H,20,21) |
| InChIKey | UMLLHWUZHGJDCB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|