C14H15Br2N3O — CID 107868181
N-[1-bromo-2-(bromomethyl)butan-2-yl]quinoxaline-5-carboxamide (PubChem CID 107868181) has the molecular formula C14H15Br2N3O and a molecular weight of 401.10 g/mol. Its IUPAC name is N-[1-bromo-2-(bromomethyl)butan-2-yl]quinoxaline-5-carboxamide.
| Compound Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]quinoxaline-5-carboxamide |
|---|---|
| PubChem CID | 107868181 |
| Molecular Formula | C14H15Br2N3O |
| Molecular Weight | 401.10 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]quinoxaline-5-carboxamide |
| SMILES | CCC(CBr)(CBr)NC(=O)c1cccc2nccnc12 |
| InChI | InChI=1S/C14H15Br2N3O/c1-2-14(8-15,9-16)19-13(20)10-4-3-5-11-12(10)18-7-6-17-11/h3-7H,2,8-9H2,1H3,(H,19,20) |
| InChIKey | UIDQRBKBJHCRTF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.10 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|