C16H19BrN2O — CID 114315222
N-[3-(bromomethyl)pentan-3-yl]quinoline-4-carboxamide (PubChem CID 114315222) has the molecular formula C16H19BrN2O and a molecular weight of 335.25 g/mol. Its IUPAC name is N-[3-(bromomethyl)pentan-3-yl]quinoline-4-carboxamide.
| Compound Name | N-[3-(bromomethyl)pentan-3-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 114315222 |
| Molecular Formula | C16H19BrN2O |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | N-[3-(bromomethyl)pentan-3-yl]quinoline-4-carboxamide |
| SMILES | CCC(CC)(CBr)NC(=O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C16H19BrN2O/c1-3-16(4-2,11-17)19-15(20)13-9-10-18-14-8-6-5-7-12(13)14/h5-10H,3-4,11H2,1-2H3,(H,19,20) |
| InChIKey | VANGRLZGJYUCIP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|