C15H26BrN3 — CID 107869179
5-bromo-2-N,2-N-bis(3-methylbutyl)pyridine-2,3-diamine (PubChem CID 107869179) has the molecular formula C15H26BrN3 and a molecular weight of 328.30 g/mol. Its IUPAC name is 5-bromo-2-N,2-N-bis(3-methylbutyl)pyridine-2,3-diamine.
| Compound Name | 5-bromo-2-N,2-N-bis(3-methylbutyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 107869179 |
| Molecular Formula | C15H26BrN3 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 5-bromo-2-N,2-N-bis(3-methylbutyl)pyridine-2,3-diamine |
| SMILES | CC(C)CCN(CCC(C)C)c1ncc(Br)cc1N |
| InChI | InChI=1S/C15H26BrN3/c1-11(2)5-7-19(8-6-12(3)4)15-14(17)9-13(16)10-18-15/h9-12H,5-8,17H2,1-4H3 |
| InChIKey | FGEBSVHHBFHYGP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |