C17H29BrN2 — CID 107869315
3-[[bis(3-methylbutyl)amino]methyl]-5-bromoaniline (PubChem CID 107869315) has the molecular formula C17H29BrN2 and a molecular weight of 341.34 g/mol. Its IUPAC name is 3-[[bis(3-methylbutyl)amino]methyl]-5-bromoaniline.
| Compound Name | 3-[[bis(3-methylbutyl)amino]methyl]-5-bromoaniline |
|---|---|
| PubChem CID | 107869315 |
| Molecular Formula | C17H29BrN2 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-[[bis(3-methylbutyl)amino]methyl]-5-bromoaniline |
| SMILES | CC(C)CCN(CCC(C)C)Cc1cc(N)cc(Br)c1 |
| InChI | InChI=1S/C17H29BrN2/c1-13(2)5-7-20(8-6-14(3)4)12-15-9-16(18)11-17(19)10-15/h9-11,13-14H,5-8,12,19H2,1-4H3 |
| InChIKey | RFTANELEHUYJBP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|