C16H28BrN3 — CID 102994556
N'-[(3-amino-5-bromophenyl)methyl]-N,N,N'-triethylpropane-1,3-diamine (PubChem CID 102994556) has the molecular formula C16H28BrN3 and a molecular weight of 342.33 g/mol. Its IUPAC name is N'-[(3-amino-5-bromophenyl)methyl]-N,N,N'-triethylpropane-1,3-diamine.
| Compound Name | N'-[(3-amino-5-bromophenyl)methyl]-N,N,N'-triethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 102994556 |
| Molecular Formula | C16H28BrN3 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N'-[(3-amino-5-bromophenyl)methyl]-N,N,N'-triethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCN(CC)Cc1cc(N)cc(Br)c1 |
| InChI | InChI=1S/C16H28BrN3/c1-4-19(5-2)8-7-9-20(6-3)13-14-10-15(17)12-16(18)11-14/h10-12H,4-9,13,18H2,1-3H3 |
| InChIKey | JGBAYKBZVUQONQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|