C16H16FNOS — CID 107879747
5-[(3,4-dimethylphenoxy)methyl]-2-fluorobenzenecarbothioamide (PubChem CID 107879747) has the molecular formula C16H16FNOS and a molecular weight of 289.38 g/mol. Its IUPAC name is 5-[(3,4-dimethylphenoxy)methyl]-2-fluorobenzenecarbothioamide.
| Compound Name | 5-[(3,4-dimethylphenoxy)methyl]-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107879747 |
| Molecular Formula | C16H16FNOS |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 5-[(3,4-dimethylphenoxy)methyl]-2-fluorobenzenecarbothioamide |
| SMILES | Cc1ccc(OCc2ccc(F)c(C(N)=S)c2)cc1C |
| InChI | InChI=1S/C16H16FNOS/c1-10-3-5-13(7-11(10)2)19-9-12-4-6-15(17)14(8-12)16(18)20/h3-8H,9H2,1-2H3,(H2,18,20) |
| InChIKey | HKQUBEJSFGFHDI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|