C14H20FNOS — CID 107879930
5-(3,3-dimethylbutoxymethyl)-2-fluorobenzenecarbothioamide (PubChem CID 107879930) has the molecular formula C14H20FNOS and a molecular weight of 269.38 g/mol. Its IUPAC name is 5-(3,3-dimethylbutoxymethyl)-2-fluorobenzenecarbothioamide.
| Compound Name | 5-(3,3-dimethylbutoxymethyl)-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107879930 |
| Molecular Formula | C14H20FNOS |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 5-(3,3-dimethylbutoxymethyl)-2-fluorobenzenecarbothioamide |
| SMILES | CC(C)(C)CCOCc1ccc(F)c(C(N)=S)c1 |
| InChI | InChI=1S/C14H20FNOS/c1-14(2,3)6-7-17-9-10-4-5-12(15)11(8-10)13(16)18/h4-5,8H,6-7,9H2,1-3H3,(H2,16,18) |
| InChIKey | ADGIGULOKAIDKS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|