C14H9Cl3FNOS — CID 107879842
2-fluoro-5-[(2,4,6-trichlorophenoxy)methyl]benzenecarbothioamide (PubChem CID 107879842) has the molecular formula C14H9Cl3FNOS and a molecular weight of 364.66 g/mol. Its IUPAC name is 2-fluoro-5-[(2,4,6-trichlorophenoxy)methyl]benzenecarbothioamide.
| Compound Name | 2-fluoro-5-[(2,4,6-trichlorophenoxy)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 107879842 |
| Molecular Formula | C14H9Cl3FNOS |
| Molecular Weight | 364.66 g/mol |
| Exact Mass | 362.95 |
| IUPAC Name | 2-fluoro-5-[(2,4,6-trichlorophenoxy)methyl]benzenecarbothioamide |
| SMILES | NC(=S)c1cc(COc2c(Cl)cc(Cl)cc2Cl)ccc1F |
| InChI | InChI=1S/C14H9Cl3FNOS/c15-8-4-10(16)13(11(17)5-8)20-6-7-1-2-12(18)9(3-7)14(19)21/h1-5H,6H2,(H2,19,21) |
| InChIKey | VDRAUBNNXGWHME-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.66 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|