C13H15F2NO2S — CID 107886675
2-(3,4-difluorophenyl)sulfonyl-3-methylhexanenitrile (PubChem CID 107886675) has the molecular formula C13H15F2NO2S and a molecular weight of 287.33 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfonyl-3-methylhexanenitrile.
| Compound Name | 2-(3,4-difluorophenyl)sulfonyl-3-methylhexanenitrile |
|---|---|
| PubChem CID | 107886675 |
| Molecular Formula | C13H15F2NO2S |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfonyl-3-methylhexanenitrile |
| SMILES | CCCC(C)C(C#N)S(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H15F2NO2S/c1-3-4-9(2)13(8-16)19(17,18)10-5-6-11(14)12(15)7-10/h5-7,9,13H,3-4H2,1-2H3 |
| InChIKey | CBUXBGQEYPIEHQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |