C17H17BrFNO4S — CID 10788733
(2S)-2-[[4-(4-bromo-2-fluorophenyl)phenyl]sulfonylamino]-3-methylbutanoic acid (PubChem CID 10788733) has the molecular formula C17H17BrFNO4S and a molecular weight of 430.30 g/mol. Its IUPAC name is (2S)-2-[[4-(4-bromo-2-fluorophenyl)phenyl]sulfonylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[4-(4-bromo-2-fluorophenyl)phenyl]sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 10788733 |
| Molecular Formula | C17H17BrFNO4S |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | (2S)-2-[[4-(4-bromo-2-fluorophenyl)phenyl]sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccc(-c2ccc(Br)cc2F)cc1)C(=O)O |
| InChI | InChI=1S/C17H17BrFNO4S/c1-10(2)16(17(21)22)20-25(23,24)13-6-3-11(4-7-13)14-8-5-12(18)9-15(14)19/h3-10,16,20H,1-2H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | UWHPJOBPMXNVII-INIZCTEOSA-N |
| XLogP | 3.64 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |