C30H54O — CID 10788786
(1S,2R,4S)-4-[(1R,3aS,4R,5S,7aR)-4-ethyl-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-4-methyl-2-prop-2-enylcyclohexan-1-ol (PubChem CID 10788786) has the molecular formula C30H54O and a molecular weight of 430.76 g/mol. Its IUPAC name is (1S,2R,4S)-4-[(1R,3aS,4R,5S,7aR)-4-ethyl-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-4-methyl-2-prop-2-enylcyclohexan-1-ol.
| Compound Name | (1S,2R,4S)-4-[(1R,3aS,4R,5S,7aR)-4-ethyl-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-4-methyl-2-prop-2-enylcyclohexan-1-ol |
|---|---|
| PubChem CID | 10788786 |
| Molecular Formula | C30H54O |
| Molecular Weight | 430.76 g/mol |
| Exact Mass | 430.42 |
| IUPAC Name | (1S,2R,4S)-4-[(1R,3aS,4R,5S,7aR)-4-ethyl-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-4-methyl-2-prop-2-enylcyclohexan-1-ol |
| SMILES | C=CC[C@@H]1C[C@@](C)([C@H]2CC[C@]3(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@H]3[C@@H]2CC)CC[C@@H]1O |
| InChI | InChI=1S/C30H54O/c1-8-11-23-20-29(6,18-17-28(23)31)26-16-19-30(7)25(14-15-27(30)24(26)9-2)22(5)13-10-12-21(3)4/h8,21-28,31H,1,9-20H2,2-7H3/t22-,23-,24-,25-,26+,27+,28+,29+,30-/m1/s1 |
| InChIKey | QREJSEAEIARQLJ-UWTSPRHSSA-N |
| XLogP | 8.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.76 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|