C30H56 — CID 144759364
(1R,3aS,4S,5S,7aR)-4-ethyl-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-5-[(3R)-2,3,6-trimethylhept-1-en-3-yl]-1,2,3,3a,4,5,6,7-octahydroindene (PubChem CID 144759364) has the molecular formula C30H56 and a molecular weight of 416.78 g/mol. Its IUPAC name is (1R,3aS,4S,5S,7aR)-4-ethyl-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-5-[(3R)-2,3,6-trimethylhept-1-en-3-yl]-1,2,3,3a,4,5,6,7-octahydroindene.
| Compound Name | (1R,3aS,4S,5S,7aR)-4-ethyl-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-5-[(3R)-2,3,6-trimethylhept-1-en-3-yl]-1,2,3,3a,4,5,6,7-octahydroindene |
|---|---|
| PubChem CID | 144759364 |
| Molecular Formula | C30H56 |
| Molecular Weight | 416.78 g/mol |
| Exact Mass | 416.44 |
| IUPAC Name | (1R,3aS,4S,5S,7aR)-4-ethyl-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-5-[(3R)-2,3,6-trimethylhept-1-en-3-yl]-1,2,3,3a,4,5,6,7-octahydroindene |
| SMILES | C=C(C)[C@](C)(CCC(C)C)[C@H]1CC[C@]2(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@H]2[C@@H]1CC |
| InChI | InChI=1S/C30H56/c1-11-25-27-16-15-26(24(8)14-12-13-21(2)3)30(27,10)20-18-28(25)29(9,23(6)7)19-17-22(4)5/h21-22,24-28H,6,11-20H2,1-5,7-10H3/t24-,25+,26-,27+,28+,29+,30-/m1/s1 |
| InChIKey | BKFBEVMFXAVEMB-QLGAQQLASA-N |
| XLogP | 9.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.78 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|