C26H53NO — CID 170742951
(4R)-4-[4,7a-dimethyl-5-(3-methylpentan-3-yl)-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentan-1-amine;butan-1-ol (PubChem CID 170742951) has the molecular formula C26H53NO and a molecular weight of 395.72 g/mol. Its IUPAC name is (4R)-4-[4,7a-dimethyl-5-(3-methylpentan-3-yl)-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentan-1-amine;butan-1-ol.
| Compound Name | (4R)-4-[4,7a-dimethyl-5-(3-methylpentan-3-yl)-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentan-1-amine;butan-1-ol |
|---|---|
| PubChem CID | 170742951 |
| Molecular Formula | C26H53NO |
| Molecular Weight | 395.72 g/mol |
| Exact Mass | 395.41 |
| IUPAC Name | (4R)-4-[4,7a-dimethyl-5-(3-methylpentan-3-yl)-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]pentan-1-amine;butan-1-ol |
| SMILES | CCC(C)(CC)C1CCC2(C)C(CCC2[C@H](C)CCCN)C1C.CCCCO |
| InChI | InChI=1S/C22H43N.C4H10O/c1-7-21(5,8-2)19-13-14-22(6)18(16(3)10-9-15-23)11-12-20(22)17(19)4;1-2-3-4-5/h16-20H,7-15,23H2,1-6H3;5H,2-4H2,1H3/t16-,17?,18?,19?,20?,22?;/m1./s1 |
| InChIKey | DGORHXMWVPXCDN-FAERIASYSA-N |
| XLogP | 7.05 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.72 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |