C41H84N4O2 — CID 144717376
N-[(4R)-4-[(7R)-7-(4-aminobutyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]heptan-1-amine;bis(3-aminopropan-1-ol) (PubChem CID 144717376) has the molecular formula C41H84N4O2 and a molecular weight of 665.15 g/mol. Its IUPAC name is N-[(4R)-4-[(7R)-7-(4-aminobutyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]heptan-1-amine;bis(3-aminopropan-1-ol).
| Compound Name | N-[(4R)-4-[(7R)-7-(4-aminobutyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]heptan-1-amine;bis(3-aminopropan-1-ol) |
|---|---|
| PubChem CID | 144717376 |
| Molecular Formula | C41H84N4O2 |
| Molecular Weight | 665.15 g/mol |
| Exact Mass | 664.66 |
| IUPAC Name | N-[(4R)-4-[(7R)-7-(4-aminobutyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]heptan-1-amine;bis(3-aminopropan-1-ol) |
| SMILES | CCCCCCCNCCC[C@@H](C)C1CCC2C3C(CCCCN)CC4CCCCC4(C)C3CCC21C.NCCCO.NCCCO |
| InChI | InChI=1S/C35H66N2.2C3H9NO/c1-5-6-7-8-13-24-37-25-14-15-27(2)30-18-19-31-33-28(16-10-12-23-36)26-29-17-9-11-21-34(29,3)32(33)20-22-35(30,31)4;2*4-2-1-3-5/h27-33,37H,5-26,36H2,1-4H3;2*5H,1-4H2/t27-,28?,29?,30?,31?,32?,33?,34?,35?;;/m1../s1 |
| InChIKey | ZVUNKAFWMJLUQX-JVOSNPCZSA-N |
| XLogP | 8.02 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.15 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|