C34H61N — CID 170112205
(7R)-7-[(1R,3aS,4S,7aR)-4-ethyl-1-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-4,7,8-trimethylnon-8-enenitrile (PubChem CID 170112205) has the molecular formula C34H61N and a molecular weight of 483.87 g/mol. Its IUPAC name is (7R)-7-[(1R,3aS,4S,7aR)-4-ethyl-1-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-4,7,8-trimethylnon-8-enenitrile.
| Compound Name | (7R)-7-[(1R,3aS,4S,7aR)-4-ethyl-1-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-4,7,8-trimethylnon-8-enenitrile |
|---|---|
| PubChem CID | 170112205 |
| Molecular Formula | C34H61N |
| Molecular Weight | 483.87 g/mol |
| Exact Mass | 483.48 |
| IUPAC Name | (7R)-7-[(1R,3aS,4S,7aR)-4-ethyl-1-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-4,7,8-trimethylnon-8-enenitrile |
| SMILES | C=C(C)[C@](C)(CCC(C)CCC#N)C1CC[C@]2(C)[C@@H]([C@H](C)CC[C@@H](CC)C(C)C)CC[C@H]2[C@@H]1CC |
| InChI | InChI=1S/C34H61N/c1-11-28(24(3)4)16-15-27(8)30-17-18-31-29(12-2)32(20-22-34(30,31)10)33(9,25(5)6)21-19-26(7)14-13-23-35/h24,26-32H,5,11-22H2,1-4,6-10H3/t26?,27-,28-,29+,30-,31+,32?,33+,34-/m1/s1 |
| InChIKey | QHLICCMTNFANGI-SGIUSOMESA-N |
| XLogP | 10.86 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.87 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|