C12H18OS — CID 107887985
(3-pentan-2-ylsulfanylphenyl)methanol (PubChem CID 107887985) has the molecular formula C12H18OS and a molecular weight of 210.34 g/mol. Its IUPAC name is (3-pentan-2-ylsulfanylphenyl)methanol.
| Compound Name | (3-pentan-2-ylsulfanylphenyl)methanol |
|---|---|
| PubChem CID | 107887985 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (3-pentan-2-ylsulfanylphenyl)methanol |
| SMILES | CCCC(C)Sc1cccc(CO)c1 |
| InChI | InChI=1S/C12H18OS/c1-3-5-10(2)14-12-7-4-6-11(8-12)9-13/h4,6-8,10,13H,3,5,9H2,1-2H3 |
| InChIKey | YVPOWODKCMWYIS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |