C20H37NO2 — CID 142121434
1-amino-3-methylpentan-2-one;2-methylpentane;(3-methylphenyl)methanol (PubChem CID 142121434) has the molecular formula C20H37NO2 and a molecular weight of 323.52 g/mol. Its IUPAC name is 1-amino-3-methylpentan-2-one;2-methylpentane;(3-methylphenyl)methanol.
| Compound Name | 1-amino-3-methylpentan-2-one;2-methylpentane;(3-methylphenyl)methanol |
|---|---|
| PubChem CID | 142121434 |
| Molecular Formula | C20H37NO2 |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.28 |
| IUPAC Name | 1-amino-3-methylpentan-2-one;2-methylpentane;(3-methylphenyl)methanol |
| SMILES | CCC(C)C(=O)CN.CCCC(C)C.Cc1cccc(CO)c1 |
| InChI | InChI=1S/C8H10O.C6H13NO.C6H14/c1-7-3-2-4-8(5-7)6-9;1-3-5(2)6(8)4-7;1-4-5-6(2)3/h2-5,9H,6H2,1H3;5H,3-4,7H2,1-2H3;6H,4-5H2,1-3H3 |
| InChIKey | CCJJEIPMQREZOH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |