C16H25NO2S — CID 83047078
2-[3-[(tert-butylamino)methyl]phenyl]sulfanylpentanoic acid (PubChem CID 83047078) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is 2-[3-[(tert-butylamino)methyl]phenyl]sulfanylpentanoic acid.
| Compound Name | 2-[3-[(tert-butylamino)methyl]phenyl]sulfanylpentanoic acid |
|---|---|
| PubChem CID | 83047078 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-[3-[(tert-butylamino)methyl]phenyl]sulfanylpentanoic acid |
| SMILES | CCCC(Sc1cccc(CNC(C)(C)C)c1)C(=O)O |
| InChI | InChI=1S/C16H25NO2S/c1-5-7-14(15(18)19)20-13-9-6-8-12(10-13)11-17-16(2,3)4/h6,8-10,14,17H,5,7,11H2,1-4H3,(H,18,19) |
| InChIKey | IFPKXQVJSFQVJW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |