C14H21N — CID 107892275
2-pentan-2-yl-1,3-dihydroinden-2-amine (PubChem CID 107892275) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 2-pentan-2-yl-1,3-dihydroinden-2-amine.
| Compound Name | 2-pentan-2-yl-1,3-dihydroinden-2-amine |
|---|---|
| PubChem CID | 107892275 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 2-pentan-2-yl-1,3-dihydroinden-2-amine |
| SMILES | CCCC(C)C1(N)Cc2ccccc2C1 |
| InChI | InChI=1S/C14H21N/c1-3-6-11(2)14(15)9-12-7-4-5-8-13(12)10-14/h4-5,7-8,11H,3,6,9-10,15H2,1-2H3 |
| InChIKey | UNBIDBABBLSFHS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |