C31H26N2O — CID 10789333
(2,3-dimethylphenyl)-(1-tritylimidazol-4-yl)methanone (PubChem CID 10789333) has the molecular formula C31H26N2O and a molecular weight of 442.56 g/mol. Its IUPAC name is (2,3-dimethylphenyl)-(1-tritylimidazol-4-yl)methanone.
| Compound Name | (2,3-dimethylphenyl)-(1-tritylimidazol-4-yl)methanone |
|---|---|
| PubChem CID | 10789333 |
| Molecular Formula | C31H26N2O |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | (2,3-dimethylphenyl)-(1-tritylimidazol-4-yl)methanone |
| SMILES | Cc1cccc(C(=O)c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)c1C |
| InChI | InChI=1S/C31H26N2O/c1-23-13-12-20-28(24(23)2)30(34)29-21-33(22-32-29)31(25-14-6-3-7-15-25,26-16-8-4-9-17-26)27-18-10-5-11-19-27/h3-22H,1-2H3 |
| InChIKey | ZXHLCLMKNSXZEJ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|