C26H29N2O+ — CID 1399321
1-(4-cyclohexylphenyl)-2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)ethanone (PubChem CID 1399321) has the molecular formula C26H29N2O+ and a molecular weight of 385.53 g/mol. Its IUPAC name is 1-(4-cyclohexylphenyl)-2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)ethanone.
| Compound Name | 1-(4-cyclohexylphenyl)-2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 1399321 |
| Molecular Formula | C26H29N2O+ |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 1-(4-cyclohexylphenyl)-2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)ethanone |
| SMILES | O=C(C[n+]1cc(-c2ccccc2)n2c1CCC2)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C26H29N2O/c29-25(23-15-13-21(14-16-23)20-8-3-1-4-9-20)19-27-18-24(22-10-5-2-6-11-22)28-17-7-12-26(27)28/h2,5-6,10-11,13-16,18,20H,1,3-4,7-9,12,17,19H2/q+1 |
| InChIKey | UVTQZGQWCQCZPF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|