C24H27N2O+ — CID 1416715
1-(4-tert-butylphenyl)-2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)ethanone (PubChem CID 1416715) has the molecular formula C24H27N2O+ and a molecular weight of 359.49 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)ethanone.
| Compound Name | 1-(4-tert-butylphenyl)-2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 1416715 |
| Molecular Formula | C24H27N2O+ |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 1-(4-tert-butylphenyl)-2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)ethanone |
| SMILES | CC(C)(C)c1ccc(C(=O)C[n+]2cc(-c3ccccc3)n3c2CCC3)cc1 |
| InChI | InChI=1S/C24H27N2O/c1-24(2,3)20-13-11-19(12-14-20)22(27)17-25-16-21(18-8-5-4-6-9-18)26-15-7-10-23(25)26/h4-6,8-9,11-14,16H,7,10,15,17H2,1-3H3/q+1 |
| InChIKey | URTBVIYLUZUBBQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|