C14H21ClO — CID 107896120
5-(chloromethyl)-1,3-dimethyl-2-pentan-2-yloxybenzene (PubChem CID 107896120) has the molecular formula C14H21ClO and a molecular weight of 240.77 g/mol. Its IUPAC name is 5-(chloromethyl)-1,3-dimethyl-2-pentan-2-yloxybenzene.
| Compound Name | 5-(chloromethyl)-1,3-dimethyl-2-pentan-2-yloxybenzene |
|---|---|
| PubChem CID | 107896120 |
| Molecular Formula | C14H21ClO |
| Molecular Weight | 240.77 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 5-(chloromethyl)-1,3-dimethyl-2-pentan-2-yloxybenzene |
| SMILES | CCCC(C)Oc1c(C)cc(CCl)cc1C |
| InChI | InChI=1S/C14H21ClO/c1-5-6-12(4)16-14-10(2)7-13(9-15)8-11(14)3/h7-8,12H,5-6,9H2,1-4H3 |
| InChIKey | AJWFLXYZPABONY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.77 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|