C11H14ClNO — CID 107899493
4-[(E)-3-chloroprop-2-enoxy]-2,5-dimethylaniline (PubChem CID 107899493) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 4-[(E)-3-chloroprop-2-enoxy]-2,5-dimethylaniline.
| Compound Name | 4-[(E)-3-chloroprop-2-enoxy]-2,5-dimethylaniline |
|---|---|
| PubChem CID | 107899493 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 4-[(E)-3-chloroprop-2-enoxy]-2,5-dimethylaniline |
| SMILES | Cc1cc(OC/C=C/Cl)c(C)cc1N |
| InChI | InChI=1S/C11H14ClNO/c1-8-7-11(14-5-3-4-12)9(2)6-10(8)13/h3-4,6-7H,5,13H2,1-2H3/b4-3+ |
| InChIKey | LEJQNHJDWOFMSJ-ONEGZZNKSA-N |
| XLogP | 3.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|